Systematic / IUPAC Name: 1-[5-Methyl-1-(2,3,4-trichlorophenyl)-1H-pyrazol-4-yl]ethanone
ID: Reference3758
Other Names: Ethanone, 1-[5-methyl-1-(2,3,4-trichlorophenyl)-1H-pyrazol-4-yl]-
Formula: C12H9Cl3N2O
1-[5-Methyl-1-(2,3,4-trichlorophenyl)-1H-pyrazol-4-yl]ethan-1-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 156 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/9/2016 10:15:40 AM |
| InChI | InChI=1S/C12H9Cl3N2O/c1-6-8(7(2)18)5-16-17(6)10-4-3-9(13)11(14)12(10)15/h3-5H,1-2H3 |
| InChI Key | SWWALZHTMPIOOC-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C=NN1C2=C(C(=C(C=C2)Cl)Cl)Cl)C(=O)C |
| CAS | |
| Splash | |
| Other Names | Ethanone, 1-[5-methyl-1-(2,3,4-trichlorophenyl)-1H-pyrazol-4-yl]- |
| ChemSpider | 2084422 |
| ChEMBL | CHEMBL1701428 |
| PubChem | 2805896 |