Systematic / IUPAC Name: N-(1-Naphthylmethyl)-2-propylaniline
ID: Reference3774
Other Names: 1-Naphthalenemethanamine, N-(2-propylphenyl)-
Formula: C20H21N
N1-(1-Naphthylmethyl)-2-propylaniline mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/10/2016 8:08:50 AM |
| InChI | InChI=1S/C20H21N/c1-2-8-17-10-4-6-14-20(17)21-15-18-12-7-11-16-9-3-5-13-19(16)18/h3-7,9-14,21H,2,8,15H2,1H3 |
| InChI Key | PWJCIRQXGRSXJN-UHFFFAOYSA-N |
| Canonical SMILES | CCCC1=CC=CC=C1NCC2=CC=CC3=CC=CC=C32 |
| CAS | |
| Splash | |
| Other Names | 1-Naphthalenemethanamine, N-(2-propylphenyl)- |