Systematic / IUPAC Name: 3-Acetyl-1,3-thiazolidine-2-carbohydrazide
ID: Reference3794
Other Names: 3-Acetylthiazolidine-2-carbohydrazide
Formula: C6H11N3O2S
3-Acetyl-1,3-thiazolane-2-carbohydrazide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/11/2016 9:35:25 AM |
| InChI | InChI=1S/C6H11N3O2S/c1-4(10)9-2-3-12-6(9)5(11)8-7/h6H,2-3,7H2,1H3,(H,8,11) |
| InChI Key | NTUFGOOFRWCMFU-UHFFFAOYSA-N |
| Canonical SMILES | CC(=O)N1CCSC1C(=O)NN |
| CAS | |
| Splash | |
| Other Names | 3-Acetylthiazolidine-2-carbohydrazide |