Systematic / IUPAC Name: 3-[5-(1-Naphthyl)-1,3,4-oxadiazol-2-yl]-5-(2-thienyl)pyridine
ID: Reference3798
Other Names: Pyridine, 3-[5-(1-naphthalenyl)-1,3,4-oxadiazol-2-yl]-5-(2-thienyl)-
Formula: C21H13N3OS
3-[5-(1-Naphthyl)-1,3,4-oxadiazol-2-yl]-5-(2-thienyl)pyridine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/11/2016 11:56:20 AM |
| InChI | InChI=1S/C21H13N3OS/c1-2-7-17-14(5-1)6-3-8-18(17)21-24-23-20(25-21)16-11-15(12-22-13-16)19-9-4-10-26-19/h1-13H |
| InChI Key | YAEXDACPYFYYQG-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C2C(=C1)C=CC=C2C3=NN=C(O3)C4=CN=CC(=C4)C5=CC=CS5 |
| CAS | |
| Splash | |
| Other Names | Pyridine, 3-[5-(1-naphthalenyl)-1,3,4-oxadiazol-2-yl]-5-(2-thienyl)- |