Systematic / IUPAC Name: 2-{Amino[5-(trifluoromethyl)-2-pyridinyl]methylene}-N-(4-chlorophenyl)hydrazinecarboxamide
ID: Reference3810
Other Names: Hydrazinecarboxamide, 2-{amino[5-(trifluoromethyl)-2-pyridinyl]methylene}-N-(4-chlorophenyl)-
Formula: C14H11ClF3N5O
N1-(4-Chlorophenyl)-2-{amino[5-(trifluoromethyl)-2-pyridyl]methylidene}hydrazine-1-carboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/15/2016 7:30:53 AM |
| InChI | InChI=1S/C14H11ClF3N5O/c15-9-2-4-10(5-3-9)21-13(24)23-22-12(19)11-6-1-8(7-20-11)14(16,17)18/h1-7H,(H2,19,22)(H2,21,23,24) |
| InChI Key | DLZDZEQEYUAOBK-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=CC=C1NC(=O)NN=C(C2=NC=C(C=C2)C(F)(F)F)N)Cl |
| CAS | |
| Splash | |
| Other Names | Hydrazinecarboxamide, 2-{amino[5-(trifluoromethyl)-2-pyridinyl]methylene}-N-(4-chlorophenyl)- |