Systematic / IUPAC Name: 1-[(E)-{[3-(4-Chlorophenyl)-1-phenyl-1H-pyrazol-4-yl]methylene}amino]-4-(4-methylphenyl)-2,5-piperazinedione
ID: Reference3821
Other Names: 2,5-Piperazinedione, 1-({(1E)-[3-(4-chlorophenyl)-1-phenyl-1H-pyrazol-4-yl]methylene}amino)-4-(4-methylphenyl)-
Formula: C27H22ClN5O2
1-({[3-(4-Chlorophenyl)-1-phenyl-1H-pyrazol-4-yl]methylene}amino)-4-(4-methylphenyl)tetrahydro-2,5-pyrazinedione mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/15/2016 8:24:59 AM |
| InChI | InChI=1S/C27H22ClN5O2/c1-19-7-13-23(14-8-19)31-17-26(35)33(18-25(31)34)29-15-21-16-32(24-5-3-2-4-6-24)30-27(21)20-9-11-22(28)12-10-20/h2-16H,17-18H2,1H3/b29-15+ |
| InChI Key | NGYKAUYSNYJQEW-WKULSOCRSA-N |
| Canonical SMILES | CC1=CC=C(C=C1)N2CC(=O)N(CC2=O)N=CC3=CN(N=C3C4=CC=C(C=C4)Cl)C5=CC=CC=C5 |
| CAS | |
| Splash | |
| Other Names | 2,5-Piperazinedione, 1-({(1E)-[3-(4-chlorophenyl)-1-phenyl-1H-pyrazol-4-yl]methylene}amino)-4-(4-methylphenyl)- |