Systematic / IUPAC Name: 3-(Allylsulfanyl)-5-(4-chlorophenyl)-4-(2,2-dimethoxyethyl)-4H-1,2,4-triazole
ID: Reference3826
Other Names: 4H-1,2,4-Triazole, 3-(4-chlorophenyl)-4-(2,2-dimethoxyethyl)-5-(2-propen-1-ylthio)-
Formula: C15H18ClN3O2S
3-(Allylthio)-5-(4-chlorophenyl)-4-(2,2-dimethoxyethyl)-4H-1,2,4-triazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/15/2016 9:15:05 AM |
| InChI | InChI=1S/C15H18ClN3O2S/c1-4-9-22-15-18-17-14(11-5-7-12(16)8-6-11)19(15)10-13(20-2)21-3/h4-8,13H,1,9-10H2,2-3H3 |
| InChI Key | DVZHNMWMBDTZIF-UHFFFAOYSA-N |
| Canonical SMILES | COC(CN1C(=NN=C1SCC=C)C2=CC=C(C=C2)Cl)OC |
| CAS | |
| Splash | |
| Other Names | 4H-1,2,4-Triazole, 3-(4-chlorophenyl)-4-(2,2-dimethoxyethyl)-5-(2-propen-1-ylthio)- |