Systematic / IUPAC Name: 2,4-Dimethyl-5-[(2-methylbenzyl)sulfanyl]pyrimidine
ID: Reference3829
Other Names: Pyrimidine, 2,4-dimethyl-5-{[(2-methylphenyl)methyl]thio}-
Formula: C14H16N2S
2,4-Dimethyl-5-[(2-methylbenzyl)thio]pyrimidine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 34 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/15/2016 9:20:28 AM |
| InChI | InChI=1S/C14H16N2S/c1-10-6-4-5-7-13(10)9-17-14-8-15-12(3)16-11(14)2/h4-8H,9H2,1-3H3 |
| InChI Key | NSAFGLSCXUCODH-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC=CC=C1CSC2=CN=C(N=C2C)C |
| CAS | |
| Splash | |
| Other Names | Pyrimidine, 2,4-dimethyl-5-{[(2-methylphenyl)methyl]thio}- |
| ChemSpider | 2026833 |
| ChEMBL | CHEMBL2138871 |
| PubChem | 2745352 |