Systematic / IUPAC Name: [[5-(4-Amino-2-oxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxyhydroxyphosphoryl]phosphono phosphate
ID: Reference383
Other Names:
[[[(2R,3S,5R)-5-(4-Amino-2-oxo-pyrimidin-1-yl)-3-hydroxy-oxolan-2-yl]methoxy-hydroxy-phosphoryl]oxy-hydroxy-phosphoryl]oxyphosphonic acid;
DCTP;
Deoxy-CTP
Formula: C9H16N3O13P3
Class: Endogenous Metabolites
Deoxycytidine triphosphate (DCTP) mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 273 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/12/2015 11:33:16 AM |
| InChI | InChI=1S/C9H16N3O13P3/c10-7-1-2-12(9(14)11-7)8-3-5(13)6(23-8)4-22-27(18,19)25-28(20,21)24-26(15,16)17/h1-2,5-6,8,13H,3-4H2,(H,18,19)(H,20,21)(H2,10,11,14)(H2,15,16,17)/t5-,6+,8+/m0/s1 |
| InChI Key | RGWHQCVHVJXOKC-SHYZEUOFSA-N |
| Canonical SMILES | C1C(C(OC1N2C=CC(=NC2=O)N)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O |
| CAS | 2056986 |
| Splash | |
| Other Names |
[[[(2R,3S,5R)-5-(4-Amino-2-oxo-pyrimidin-1-yl)-3-hydroxy-oxolan-2-yl]methoxy-hydroxy-phosphoryl]oxy-hydroxy-phosphoryl]oxyphosphonic acid; DCTP; Deoxy-CTP |
| ChEMBL | CHEMBL560403 |
| ChemSpider | 605; 21232344; 21232860; 21238881 |
| KEGG | C00458 |
| HMDb | HMDB00998 |
| ChEBI | CHEBI:16311 |
| PubChem | 65091 |
| Wikipedia | Deoxycytidine_triphosphate |
| ChemIDPlus | 002056986 |