Systematic / IUPAC Name: 5-(2-Pyridinyl)-1,3,4-thiadiazole-2(3H)-thione
ID: Reference3838
Other Names: 1,3,4-Thiadiazole-2(3H)-thione, 5-(2-pyridinyl)-
Formula: C7H5N3S2
5-(2-Pyridyl)-2,3-dihydro-1,3,4-thiadiazole-2-thione mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/15/2016 10:12:32 AM |
| InChI | InChI=1S/C7H5N3S2/c11-7-10-9-6(12-7)5-3-1-2-4-8-5/h1-4H,(H,10,11) |
| InChI Key | NURSZUJTABWSTA-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=NC(=C1)C2=NNC(=S)S2 |
| CAS | |
| Splash | |
| Other Names | 1,3,4-Thiadiazole-2(3H)-thione, 5-(2-pyridinyl)- |
| ChEMBL | CHEMBL2064049 |
| ChemSpider | 2014497 |
| PubChem | 2732684 |