Systematic / IUPAC Name: S-[2-[3-[[4-[[[5-(6-Aminopurin-9-yl)-4-hydroxy-3-phosphonooxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-2-hydroxy-3,3-dimethylbutanoyl]amino]propanoylamino]ethyl] decanethioate
ID: Reference385
Other Names:
Coenzyme A, S-decanoate;
Decanoyl-CoA;
Capryl-CoA;
Capryl-Coenzyme A
Formula: C31H54N7O17P3S
Class: Endogenous Metabolites
Decanoyl-coenzyme A mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 342 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/15/2015 9:50:18 AM |
| InChI | InChI=1S/C31H54N7O17P3S/c1-4-5-6-7-8-9-10-11-22(40)59-15-14-33-21(39)12-13-34-29(43)26(42)31(2,3)17-52-58(49,50)55-57(47,48)51-16-20-25(54-56(44,45)46)24(41)30(53-20)38-19-37-23-27(32)35-18-36-28(23)38/h18-20,24-26,30,41-42H,4-17H2,1-3H3,(H,33,39)(H,34,43)(H,47,48)(H,49,50)(H2,32,35,36)(H2,44,45,46)/t20-,24-,25-,26+,30-/m1/s1 |
| InChI Key | CNKJPHSEFDPYDB-HSJNEKGZSA-N |
| Canonical SMILES | O=C(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O)OP(=O)(O)OCC3OC(n2cnc1c(ncnc12)N)C(O)C3OP(=O)(O)O)CCCCCCCCC |
| CAS | 1264579 |
| Splash | |
| Other Names |
Coenzyme A, S-decanoate; Decanoyl-CoA; Capryl-CoA; Capryl-Coenzyme A |
| KEGG | C05274 |
| ChemSpider | 144473 |
| PubChem | 164800 |
| ChemIDPlus | 001264579 |
| ChEBI | CHEBI:28493 |