Systematic / IUPAC Name: 5-(4-Methoxyphenyl)-N-[(5-methyl-2-phenyl-2H-1,2,3-triazol-4-yl)methyl]-1,3-oxazole-4-carboxamide
ID: Reference3850
Other Names: 4-Oxazolecarboxamide, 5-(4-methoxyphenyl)-N-[(5-methyl-2-phenyl-2H-1,2,3-triazol-4-yl)methyl]-
Formula: C21H19N5O3
5-(4-Methoxyphenyl)-N-[(5-methyl-2-phenyl-2H-1,2,3-triazol-4-yl)methyl]-1,3-oxazole-4-carboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/15/2016 1:56:49 PM |
| InChI | InChI=1S/C21H19N5O3/c1-14-18(25-26(24-14)16-6-4-3-5-7-16)12-22-21(27)19-20(29-13-23-19)15-8-10-17(28-2)11-9-15/h3-11,13H,12H2,1-2H3,(H,22,27) |
| InChI Key | XQSPWVRPKGJIDF-UHFFFAOYSA-N |
| Canonical SMILES | CC1=NN(N=C1CNC(=O)C2=C(OC=N2)C3=CC=C(C=C3)OC)C4=CC=CC=C4 |
| CAS | |
| Splash | |
| Other Names | 4-Oxazolecarboxamide, 5-(4-methoxyphenyl)-N-[(5-methyl-2-phenyl-2H-1,2,3-triazol-4-yl)methyl]- |
| ChemSpider | 2020549 |
| ChEMBL | CHEMBL1306416 |
| PubChem | 2738924 |