Systematic / IUPAC Name: 4-(3,12-Dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoic acid
ID: Reference388
Other Names:
3α,12α-Dihydroxy-5β-cholan-24-oic acid;
3α,12α-Dihydroxy-5β-cholanate;
Cholan-24-oic acid, 3,12-dihydroxy-, (3-α,5-β,12-α)-;
Choleic acid;
7α-Deoxycholic acid
; more
Formula: C24H40O4
Class: Endogenous Metabolites
Deoxycholic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Orbitrap Fusion with FAIMS |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1822 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 6/18/2020 1:30:33 PM |
| InChI | InChI=1S/C24H40O4/c1-14(4-9-22(27)28)18-7-8-19-17-6-5-15-12-16(25)10-11-23(15,2)20(17)13-21(26)24(18,19)3/h14-21,25-26H,4-13H2,1-3H3,(H,27,28)/t14-,15-,16-,17+,18-,19+,20+,21+,23+,24-/m1/s1 |
| InChI Key | KXGVEGMKQFWNSR-LLQZFEROSA-N |
| Canonical SMILES | O=C(O)CCC(C4CCC3C2C(C1(C)CCC(O)CC1CC2)CC(O)C34C)C |
| CAS | 83443 |
| Splash | |
| Other Names |
3α,12α-Dihydroxy-5β-cholan-24-oic acid; 3α,12α-Dihydroxy-5β-cholanate; Cholan-24-oic acid, 3,12-dihydroxy-, (3-α,5-β,12-α)-; Choleic acid; 7α-Deoxycholic acid; Degalol; Deoxycholatic acid; Droxolan; Pyrochol; Septochol; Cholic acid, deoxy-; DXC |
| PubChem | 222528 |
| KEGG | C11171; C04483 |
| LipidsMAPs | LMST04010040 |
| HMDb | HMDB00626 |
| ChemIDPlus | 000302954; 115349149 |
| Wikipedia | Deoxycholic_acid |
| ChEBI | CHEBI:28834 |
| ChemSpider | 193196 |
| ChEMBL | CHEMBL406393 |