Systematic / IUPAC Name: [4-(2-Methoxyphenyl)-1-piperidinyl]{2-[(4-methylphenyl)sulfanyl]-3-pyridinyl}methanone
ID: Reference3883
Other Names: Methanone, [4-(2-methoxyphenyl)-1-piperidinyl]{2-[(4-methylphenyl)thio]-3-pyridinyl}-
Formula: C25H26N2O2S
[4-(2-Methoxyphenyl)piperidino]{2-[(4-methylphenyl)thio]pyridin-3-yl}methanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/16/2016 11:39:41 AM |
| InChI | InChI=1S/C25H26N2O2S/c1-18-9-11-20(12-10-18)30-24-22(7-5-15-26-24)25(28)27-16-13-19(14-17-27)21-6-3-4-8-23(21)29-2/h3-12,15,19H,13-14,16-17H2,1-2H3 |
| InChI Key | WMBSQAPNVKLNDD-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC=C(C=C1)SC2=C(C=CC=N2)C(=O)N3CCC(CC3)C4=CC=CC=C4OC |
| CAS | |
| Splash | |
| Other Names | Methanone, [4-(2-methoxyphenyl)-1-piperidinyl]{2-[(4-methylphenyl)thio]-3-pyridinyl}- |