Systematic / IUPAC Name: 1,5-Bis(2,5-dimethoxyphenyl)-1,5-pentanedione
ID: Reference3902
Other Names: 1,5-Pentanedione, 1,5-bis(2,5-dimethoxyphenyl)-
Formula: C21H24O6
1,5-Bis(2,5-dimethoxyphenyl)pentane-1,5-dione mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/17/2016 9:50:15 AM |
| InChI | InChI=1S/C21H24O6/c1-24-14-8-10-20(26-3)16(12-14)18(22)6-5-7-19(23)17-13-15(25-2)9-11-21(17)27-4/h8-13H,5-7H2,1-4H3 |
| InChI Key | BXZTVDWJXIYBAO-UHFFFAOYSA-N |
| Canonical SMILES | COC1=CC(=C(C=C1)OC)C(=O)CCCC(=O)C2=C(C=CC(=C2)OC)OC |
| CAS | 10365227 |
| Splash | |
| Other Names | 1,5-Pentanedione, 1,5-bis(2,5-dimethoxyphenyl)- |
| ChEMBL | CHEMBL1420686 |
| PubChem | 2729481 |
| ChemSpider | 2011437 |