Systematic / IUPAC Name: (3-Chloroadamantan-1-yl)acetic acid
ID: Reference3924
Other Names: Tricyclo[3.3.1.13,7]decane-1-acetic acid, 3-chloro-
Formula: C12H17ClO2
2-(3-Chloro-1-adamantyl)acetic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 57 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/18/2016 12:05:42 PM |
| InChI | InChI=1S/C12H17ClO2/c13-12-4-8-1-9(5-12)3-11(2-8,7-12)6-10(14)15/h8-9H,1-7H2,(H,14,15) |
| InChI Key | JLHRDMZSPPRYGL-UHFFFAOYSA-N |
| Canonical SMILES | C1C2CC3(CC1CC(C2)(C3)Cl)CC(=O)O |
| CAS | |
| Splash | |
| Other Names | Tricyclo[3.3.1.13,7]decane-1-acetic acid, 3-chloro- |