Systematic / IUPAC Name: 4-Pentyl-5-(4-pyridinyl)-2,4-dihydro-3H-1,2,4-triazole-3-thione
ID: Reference3926
Other Names: 4-Pentyl-5-(pyridin-4-yl)-4H-1,2,4-triazole-3-thiol
Formula: C12H16N4S
4-Pentyl-3-(4-pyridyl)-4,5-dihydro-1H-1,2,4-triazole-5-thione mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/18/2016 12:10:49 PM |
| InChI | InChI=1S/C12H16N4S/c1-2-3-4-9-16-11(14-15-12(16)17)10-5-7-13-8-6-10/h5-8H,2-4,9H2,1H3,(H,15,17) |
| InChI Key | VSQDOCBKCDZNFN-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | 4-Pentyl-5-(pyridin-4-yl)-4H-1,2,4-triazole-3-thiol |