Systematic / IUPAC Name: 3-Isopropyl-3-methyl-3H-imidazo[2,1-a]isoindole-2,5-dione
ID: Reference3931
Other Names:
Formula: C14H14N2O2
3-Isopropyl-3-methyl-2,5-dihydro-3H-imidazo[2,1-a]isoindole-2,5-dione mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/22/2016 7:46:44 AM |
| InChI | InChI=1S/C14H14N2O2/c1-8(2)14(3)13(18)15-11-9-6-4-5-7-10(9)12(17)16(11)14/h4-8H,1-3H3 |
| InChI Key | IRZIRPLBWVYQDJ-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)C1(C(=O)N=C2N1C(=O)C3=CC=CC=C32)C |
| CAS | |
| Splash | |
| Other Names |
| PubChem | 2729247 |
| ChEMBL | CHEMBL1439157 |
| ChemSpider | 2011206 |