Systematic / IUPAC Name: 4-Methyl-5-[(phenylsulfanyl)methyl]-2,4-dihydro-3H-1,2,4-triazole-3-thione
ID: Reference3943
Other Names: 4-Methyl-5-[(phenylthio)methyl]-4H-1,2,4-triazole-3-thiol
Formula: C10H11N3S2
4-Methyl-5-[(phenylthio)methyl]-4H-1,2,4-triazole-3-thiol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 234 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/24/2016 9:17:06 AM |
| InChI | InChI=1S/C10H11N3S2/c1-13-9(11-12-10(13)14)7-15-8-5-3-2-4-6-8/h2-6H,7H2,1H3,(H,12,14) |
| InChI Key | VAAKURABAPVEEN-UHFFFAOYSA-N |
| Canonical SMILES | CN1C(=NNC1=S)CSC2=CC=CC=C2 |
| CAS | |
| Splash | |
| Other Names | 4-Methyl-5-[(phenylthio)methyl]-4H-1,2,4-triazole-3-thiol |