Systematic / IUPAC Name: N'',N'''-Bis[(E)-(4-hydroxyphenyl)methylene]carbonohydrazide
ID: Reference3951
Other Names:
N'',N'''-bis(4-Hydroxybenzylidene)carbonic dihydrazide ;
Carbonic dihydrazide, N'',N'''-bis[(1E)-(4-hydroxyphenyl)methylene]-
Formula: C15H14N4O3
N'',N'''-Bis(4-hydroxybenzylidene)carbonic dihydrazide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 234 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/25/2016 7:01:47 AM |
| InChI | InChI=1S/C15H14N4O3/c20-13-5-1-11(2-6-13)9-16-18-15(22)19-17-10-12-3-7-14(21)8-4-12/h1-10,20-21H,(H2,18,19,22)/b16-9+,17-10+ |
| InChI Key | UPZUZADDSBPADJ-CZCYGEDCSA-N |
| Canonical SMILES | c1c(ccc(c1)O)/C=N/NC(=O)N/N=C/c2ccc(cc2)O |
| CAS | |
| Splash | |
| Other Names |
N'',N'''-bis(4-Hydroxybenzylidene)carbonic dihydrazide ; Carbonic dihydrazide, N'',N'''-bis[(1E)-(4-hydroxyphenyl)methylene]- |
| ChemSpider | 17925822 |