Systematic / IUPAC Name: 8-Chloro-2-phenyl-6-(trifluoromethyl)imidazo[1,2-a]pyridine
ID: Reference3958
Other Names: Imidazo[1,2-a]pyridine, 8-chloro-2-phenyl-6-(trifluoromethyl)-
Formula: C14H8ClF3N2
8-Chloro-2-phenyl-6-(trifluoromethyl)imidazo[1,2-a]pyridine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/25/2016 1:12:39 PM |
| InChI | InChI=1S/C14H8ClF3N2/c15-11-6-10(14(16,17)18)7-20-8-12(19-13(11)20)9-4-2-1-3-5-9/h1-8H |
| InChI Key | ATHNSQRFCXRPMB-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)C2=CN3C=C(C=C(C3=N2)Cl)C(F)(F)F |
| CAS | |
| Splash | |
| Other Names | Imidazo[1,2-a]pyridine, 8-chloro-2-phenyl-6-(trifluoromethyl)- |
| ChemSpider | 2007901 |
| PubChem | 2725829 |
| ChEMBL | CHEMBL1376360 |