Systematic / IUPAC Name: 3,3-Dimethyl-5-oxo-5-[4-(2-pyrimidinyl)-1-piperazinyl]pentanoic acid
ID: Reference3980
Other Names:
3,3-Dimethyl-5-oxo-5-[4-(pyrimidin-2-yl)piperazin-1-yl]pentanoic acid;
1-Piperazinepentanoic acid, β,β-dimethyl-δ-oxo-4-(2-pyrimidinyl)-
Formula: C15H22N4O3
3,3-Dimethyl-5-oxo-5-[4-(2-pyrimidinyl)piperazino]pentanoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/26/2016 12:52:09 PM |
| InChI | InChI=1S/C15H22N4O3/c1-15(2,11-13(21)22)10-12(20)18-6-8-19(9-7-18)14-16-4-3-5-17-14/h3-5H,6-11H2,1-2H3,(H,21,22) |
| InChI Key | XTRHXSWVHXVFSR-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)(CC(=O)N1CCN(CC1)C2=NC=CC=N2)CC(=O)O |
| CAS | |
| Splash | |
| Other Names |
3,3-Dimethyl-5-oxo-5-[4-(pyrimidin-2-yl)piperazin-1-yl]pentanoic acid; 1-Piperazinepentanoic acid, β,β-dimethyl-δ-oxo-4-(2-pyrimidinyl)- |