Systematic / IUPAC Name: 1-(Benzylamino)-3-(3,4-dimethylphenoxy)-2-propanol
ID: Reference3983
Other Names: Benzyl[3-(3,4-dimethylphenoxy)-2-hydroxypropyl]amine
Formula: C18H23NO2
1-(Benzylamino)-3-(3,4-dimethylphenoxy)propan-2-ol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/27/2016 8:36:13 AM |
| InChI | InChI=1S/C18H23NO2/c1-14-8-9-18(10-15(14)2)21-13-17(20)12-19-11-16-6-4-3-5-7-16/h3-10,17,19-20H,11-13H2,1-2H3 |
| InChI Key | HEFPHRMJPGVGHY-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C=C(C=C1)OCC(CNCC2=CC=CC=C2)O)C |
| CAS | |
| Splash | |
| Other Names | Benzyl[3-(3,4-dimethylphenoxy)-2-hydroxypropyl]amine |
| PubChem | 2796006 |
| ChEMBL | CHEMBL1876645 |
| ChemSpider | 2074882 |