Systematic / IUPAC Name: Ethyl 5-{[(1,3-benzoxazol-2-ylsulfanyl)acetyl]amino}-1-phenyl-1H-pyrazole-4-carboxylate
ID: Reference3984
Other Names: 1H-Pyrazole-4-carboxylic acid, 5-{[2-(2-benzoxazolylthio)acetyl]amino}-1-phenyl-, ethyl ester
Formula: C21H18N4O4S
Ethyl 5-{[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]amino}-1-phenyl-1H-pyrazole-4-carboxylate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/27/2016 8:20:42 AM |
| InChI | InChI=1S/C21H18N4O4S/c1-2-28-20(27)15-12-22-25(14-8-4-3-5-9-14)19(15)24-18(26)13-30-21-23-16-10-6-7-11-17(16)29-21/h3-12H,2,13H2,1H3,(H,24,26) |
| InChI Key | HGCIJWLRHXBCGU-UHFFFAOYSA-N |
| Canonical SMILES | CCOC(=O)C1=C(N(N=C1)C2=CC=CC=C2)NC(=O)CSC3=NC4=CC=CC=C4O3 |
| CAS | |
| Splash | |
| Other Names | 1H-Pyrazole-4-carboxylic acid, 5-{[2-(2-benzoxazolylthio)acetyl]amino}-1-phenyl-, ethyl ester |