Systematic / IUPAC Name: 5-Thiophen-2-ylpyridine-3-carboxylic acid
ID: Reference3990
Other Names:
5-(Thien-2-yl)nicotinic acid;
5-(Thiophen-2-yl)nicotinic acid;
5-(2-Thienyl)pyridine-3-carboxylic acid;
5-(Thiophen-2-yl)pyridine-3-carboxylic acid
Formula: C10H7NO2S
5-(2-Thienyl)nicotinic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 223 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/27/2016 10:11:46 AM |
| InChI | InChI=1S/C10H7NO2S/c12-10(13)8-4-7(5-11-6-8)9-2-1-3-14-9/h1-6H,(H,12,13) |
| InChI Key | DFWKRZGYBOVSKW-UHFFFAOYSA-N |
| Canonical SMILES | C1=CSC(=C1)C2=CC(=CN=C2)C(=O)O |
| CAS | 306934963 |
| Splash | |
| Other Names |
5-(Thien-2-yl)nicotinic acid; 5-(Thiophen-2-yl)nicotinic acid; 5-(2-Thienyl)pyridine-3-carboxylic acid; 5-(Thiophen-2-yl)pyridine-3-carboxylic acid |