Systematic / IUPAC Name: Ethyl N-{[2-(methylsulfanyl)-3-pyridinyl]carbonyl}glycinate
ID: Reference4010
Other Names: Glycine, N-{[2-(methylthio)-3-pyridinyl]carbonyl}, ethyl ester
Formula: C11H14N2O3S
Ethyl 2-({[2-(methylthio)-3-pyridyl]carbonyl}amino)acetate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 234 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/29/2016 1:27:43 PM |
| InChI | InChI=1S/C11H14N2O3S/c1-3-16-9(14)7-13-10(15)8-5-4-6-12-11(8)17-2/h4-6H,3,7H2,1-2H3,(H,13,15) |
| InChI Key | MIAWRLCCUGFSNL-UHFFFAOYSA-N |
| Canonical SMILES | CCOC(=O)CNC(=O)C1=C(N=CC=C1)SC |
| CAS | |
| Splash | |
| Other Names | Glycine, N-{[2-(methylthio)-3-pyridinyl]carbonyl}, ethyl ester |