Systematic / IUPAC Name: 1,3-Dimethyl-6-(4-morpholinyl)-2,4(1H,3H)-pyrimidinedione
ID: Reference4015
Other Names: 1,3-Dimethyl-6-morpholino-2,4(1H,3H)-pyrimidinedione
Formula: C10H15N3O3
1,3-Dimethyl-6-morpholino-1,2,3,4-tetrahydropyrimidine-2,4-dione mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/1/2016 9:35:07 AM |
| InChI | InChI=1S/C10H15N3O3/c1-11-8(13-3-5-16-6-4-13)7-9(14)12(2)10(11)15/h7H,3-6H2,1-2H3 |
| InChI Key | GIHLOYIOGWLQNV-UHFFFAOYSA-N |
| Canonical SMILES | CN1C(=CC(=O)N(C1=O)C)N2CCOCC2 |
| CAS | |
| Splash | |
| Other Names | 1,3-Dimethyl-6-morpholino-2,4(1H,3H)-pyrimidinedione |
| PubChem | 2801167 |
| ChEMBL | CHEMBL1866883 |
| ChemSpider | 2079880 |