Systematic / IUPAC Name: Dimethyl 4-oxo-1,4-dihydrothieno[3,4-b]pyridine-2,3-dicarboxylate
ID: Reference4029
Other Names: Thieno[3,4-b]pyridine-2,3-dicarboxylic acid, 1,4-dihydro-4-oxo-, dimethyl ester
Formula: C11H9NO5S
Dimethyl 4-oxo-1,4-dihydrothieno[3,4-b]pyridine-2,3-dicarboxylate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/1/2016 2:19:18 PM |
| InChI | InChI=1S/C11H9NO5S/c1-16-10(14)7-8(11(15)17-2)12-6-4-18-3-5(6)9(7)13/h3-4,12H,1-2H3 |
| InChI Key | FBAWMDJIXFQRSZ-UHFFFAOYSA-N |
| Canonical SMILES | COC(=O)C1=C(NC2=CSC=C2C1=O)C(=O)OC |
| CAS | |
| Splash | |
| Other Names | Thieno[3,4-b]pyridine-2,3-dicarboxylic acid, 1,4-dihydro-4-oxo-, dimethyl ester |