Systematic / IUPAC Name: Cyclohexyl{[(8-methyl-8-azabicyclo[3.2.1]oct-3-ylidene)amino]oxy}methanone
ID: Reference4044
Other Names:
Formula: C15H24N2O2
3-{[(Cyclohexylcarbonyl)oxy]imino}-8-methyl-8-azabicyclo[3.2.1]octane mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 67 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/2/2016 2:22:22 PM |
| InChI | InChI=1S/C15H24N2O2/c1-17-13-7-8-14(17)10-12(9-13)16-19-15(18)11-5-3-2-4-6-11/h11,13-14H,2-10H2,1H3 |
| InChI Key | WTMTUVSXDOKSQV-UHFFFAOYSA-N |
| Canonical SMILES | CN1C2CCC1CC(=NOC(=O)C3CCCCC3)C2 |
| CAS | |
| Splash | |
| Other Names |