Systematic / IUPAC Name: {2-Oxo-2-[4-(1H-pyrrol-1-yl)-1-piperidinyl]ethoxy}acetic acid
ID: Reference4046
Other Names: Acetic acid, 2-[2-oxo-2-[4-(1H-pyrrol-1-yl)-1-piperidinyl]ethoxy]-
Formula: C13H18N2O4
2-{2-Oxo-2-[4-(1H-pyrrol-1-yl)piperidino]ethoxy}acetic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/2/2016 2:41:44 PM |
| InChI | InChI=1S/C13H18N2O4/c16-12(9-19-10-13(17)18)15-7-3-11(4-8-15)14-5-1-2-6-14/h1-2,5-6,11H,3-4,7-10H2,(H,17,18) |
| InChI Key | CTFDOZUUGNTVSG-UHFFFAOYSA-N |
| Canonical SMILES | C1CN(CCC1N2C=CC=C2)C(=O)COCC(=O)O |
| CAS | |
| Splash | |
| Other Names | Acetic acid, 2-[2-oxo-2-[4-(1H-pyrrol-1-yl)-1-piperidinyl]ethoxy]- |