Systematic / IUPAC Name: 3-(1,3-Benzothiazol-2-yl)-6-ethyl-4-oxo-4H-chromen-7-yl acetate
ID: Reference4069
Other Names:
3-(Benzo[d]thiazol-2-yl)-6-ethyl-4-oxo-4H-chromen-7-yl acetate;
3-Benzothiazol-2-yl-6-ethyl-4-oxochromen-7-yl acetate;
Acetic acid 3-benzothiazol-2-yl-6-ethyl-4-oxo-4H-chromen-7-yl ester
Formula: C20H15NO4S
3-(1,3-Benzothiazol-2-yl)-6-ethyl-4-oxo-4H-chromen-7-yl acetate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/4/2016 12:32:26 PM |
| InChI | InChI=1S/C20H15NO4S/c1-3-12-8-13-17(9-16(12)25-11(2)22)24-10-14(19(13)23)20-21-15-6-4-5-7-18(15)26-20/h4-10H,3H2,1-2H3 |
| InChI Key | TVGLQJDNISRITO-UHFFFAOYSA-N |
| Canonical SMILES | CCC1=C(C=C2C(=C1)C(=O)C(=CO2)C3=NC4=CC=CC=C4S3)OC(=O)C |
| CAS | |
| Splash | |
| Other Names |
3-(Benzo[d]thiazol-2-yl)-6-ethyl-4-oxo-4H-chromen-7-yl acetate; 3-Benzothiazol-2-yl-6-ethyl-4-oxochromen-7-yl acetate; Acetic acid 3-benzothiazol-2-yl-6-ethyl-4-oxo-4H-chromen-7-yl ester |