Systematic / IUPAC Name: N-(1,3-Benzodioxol-5-ylmethyl)-2-phenoxynicotinamide
ID: Reference4077
Other Names: 3-Pyridinecarboxamide, N-(1,3-benzodioxol-5-ylmethyl)-2-phenoxy-
Formula: C20H16N2O4
N-(1,3-Benzodioxol-5-ylmethyl)-2-phenoxynicotinamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 236 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/7/2016 9:12:36 AM |
| InChI | InChI=1S/C20H16N2O4/c23-19(22-12-14-8-9-17-18(11-14)25-13-24-17)16-7-4-10-21-20(16)26-15-5-2-1-3-6-15/h1-11H,12-13H2,(H,22,23) |
| InChI Key | VGRYUWWPNTVXIP-UHFFFAOYSA-N |
| Canonical SMILES | C1OC2=C(O1)C=C(C=C2)CNC(=O)C3=C(N=CC=C3)OC4=CC=CC=C4 |
| CAS | |
| Splash | |
| Other Names | 3-Pyridinecarboxamide, N-(1,3-benzodioxol-5-ylmethyl)-2-phenoxy- |