Systematic / IUPAC Name: 4-Cyano-5-(methylsulfanyl)-N-[3-(trifluoromethyl)phenyl]-2-thiophenecarboxamide
ID: Reference4086
Other Names:
Formula: C14H9F3N2OS2
N2-[3-(Trifluoromethyl)phenyl]-4-cyano-5-(methylthio)thiophene-2-carboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 234 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/7/2016 1:42:25 PM |
| InChI | InChI=1S/C14H9F3N2OS2/c1-21-13-8(7-18)5-11(22-13)12(20)19-10-4-2-3-9(6-10)14(15,16)17/h2-6H,1H3,(H,19,20) |
| InChI Key | JJCTZXDTYKUMPD-UHFFFAOYSA-N |
| Canonical SMILES | CSC1=C(C=C(S1)C(=O)NC2=CC=CC(=C2)C(F)(F)F)C#N |
| CAS | |
| Splash | |
| Other Names |