Systematic / IUPAC Name: 3-Chloro-N'-(2,6-dichlorophenyl)-2-thiophenecarbohydrazide
ID: Reference4089
Other Names:
Formula: C11H7Cl3N2OS
3-Chloro-N'-(2,6-dichlorophenyl)-2-thiophenecarbohydrazide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/7/2016 3:20:32 PM |
| InChI | InChI=1S/C11H7Cl3N2OS/c12-6-2-1-3-7(13)9(6)15-16-11(17)10-8(14)4-5-18-10/h1-5,15H,(H,16,17) |
| InChI Key | QTSPCOIMSWKKOW-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=C(C(=C1)Cl)NNC(=O)C2=C(C=CS2)Cl)Cl |
| CAS | |
| Splash | |
| Other Names |
| ChEMBL | CHEMBL1320620 |
| ChemSpider | 2091283 |
| PubChem | 2812879 |