Systematic / IUPAC Name: Methyl 3-({[2,6-dioxo-4-(2-thienyl)cyclohexylidene]methyl}amino)-2-thiophenecarboxylate
ID: Reference4095
Other Names: 2-Thiophenecarboxylic acid, 3-({[2,6-dioxo-4-(2-thienyl)cyclohexylidene]methyl}amino)-, methyl ester
Formula: C17H15NO4S2
Methyl 3-({[2,6-dioxo-4-(2-thienyl)cyclohexyliden]methyl}amino)thiophene-2-carboxylate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 234 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/8/2016 9:35:45 AM |
| InChI | InChI=1S/C17H15NO4S2/c1-22-17(21)16-12(4-6-24-16)18-9-11-13(19)7-10(8-14(11)20)15-3-2-5-23-15/h2-6,9-10,18H,7-8H2,1H3/b11-9- |
| InChI Key | LDQKVCIPXGVMHI-LUAWRHEFSA-N |
| Canonical SMILES | COC(=O)c1c(ccs1)NC=C2C(=O)CC(CC2=O)c3cccs3 |
| CAS | |
| Splash | |
| Other Names | 2-Thiophenecarboxylic acid, 3-({[2,6-dioxo-4-(2-thienyl)cyclohexylidene]methyl}amino)-, methyl ester |