Systematic / IUPAC Name: 4-(Methylsulfanyl)phenyl phenylcarbamate
ID: Reference4100
Other Names: Phenol, 4-(methylthio)-, phenylcarbamate
Formula: C14H13NO2S
4-(Methylthio)phenyl N-phenylcarbamate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/8/2016 12:32:36 PM |
| InChI | InChI=1S/C14H13NO2S/c1-18-13-9-7-12(8-10-13)17-14(16)15-11-5-3-2-4-6-11/h2-10H,1H3,(H,15,16) |
| InChI Key | VXHBGRBYTOBTMH-UHFFFAOYSA-N |
| Canonical SMILES | CSC1=CC=C(C=C1)OC(=O)NC2=CC=CC=C2 |
| CAS | 92199843 |
| Splash | |
| Other Names | Phenol, 4-(methylthio)-, phenylcarbamate |