Systematic / IUPAC Name: 2-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-2,3-dihydrochromen-4-one
ID: Reference411
Other Names:
(2S)-2-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-2,3-dihydro-4H-chromen-4-one;
(S)-2-(3,4-Dihydroxyphenyl)-2,3-dihydro-5,7-dihydroxy-4-benzopyrone;
Eriodictiol
Formula: C15H12O6
Class: Endogenous Metabolites
Eriodictyol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 3 |
| No. of Spectra | 2485 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI; NSI |
| Analyzers | IT; FT |
| Last Modification | 11/20/2015 10:58:14 AM |
| InChI | InChI=1S/C15H12O6/c16-8-4-11(19)15-12(20)6-13(21-14(15)5-8)7-1-2-9(17)10(18)3-7/h1-5,13,16-19H,6H2/t13-/m0/s1 |
| InChI Key | SBHXYTNGIZCORC-ZDUSSCGKSA-N |
| Canonical SMILES | C1C(OC2=CC(=CC(=C2C1=O)O)O)C3=CC(=C(C=C3)O)O |
| CAS | 552589 |
| Splash | |
| Other Names |
(2S)-2-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-2,3-dihydro-4H-chromen-4-one; (S)-2-(3,4-Dihydroxyphenyl)-2,3-dihydro-5,7-dihydroxy-4-benzopyrone; Eriodictiol |
| HMDb | HMDB05810 |
| ChEMBL | CHEMBL8996 |
| PubChem | 440735 |
| KEGG | C05631 |
| Wikipedia | Eriodictyol |
| ChEBI | CHEBI:28412 |
| ChemSpider | 389606 |