Systematic / IUPAC Name: N-[5-(1-Octyn-1-yl)-3-pyridinyl]-4-phenyl-1-piperazinecarboxamide
ID: Reference4113
Other Names: 1-Piperazinecarboxamide, N-[5-(1-octyn-1-yl)-3-pyridinyl]-4-phenyl-
Formula: C24H30N4O
N1-(5-Oct-1-ynyl-3-pyridyl)-4-phenylpiperazine-1-carboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 194 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/9/2016 9:50:20 AM |
| InChI | InChI=1S/C24H30N4O/c1-2-3-4-5-6-8-11-21-18-22(20-25-19-21)26-24(29)28-16-14-27(15-17-28)23-12-9-7-10-13-23/h7,9-10,12-13,18-20H,2-6,14-17H2,1H3,(H,26,29) |
| InChI Key | KWDVQHFWXRWFEU-UHFFFAOYSA-N |
| Canonical SMILES | CCCCCCC#CC1=CC(=CN=C1)NC(=O)N2CCN(CC2)C3=CC=CC=C3 |
| CAS | |
| Splash | |
| Other Names | 1-Piperazinecarboxamide, N-[5-(1-octyn-1-yl)-3-pyridinyl]-4-phenyl- |