Systematic / IUPAC Name: N-(3,5-Dibromobenzoyl)-1-piperidinecarboxamide
ID: Reference4121
Other Names:
Formula: C13H14Br2N2O2
3,5-Dibromo-N-(piperidinocarbonyl)benzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 182 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/9/2016 12:52:36 PM |
| InChI | InChI=1S/C13H14Br2N2O2/c14-10-6-9(7-11(15)8-10)12(18)16-13(19)17-4-2-1-3-5-17/h6-8H,1-5H2,(H,16,18,19) |
| InChI Key | BKGLPNLEGUMLAB-UHFFFAOYSA-N |
| Canonical SMILES | C1CCN(CC1)C(=O)NC(=O)C2=CC(=CC(=C2)Br)Br |
| CAS | |
| Splash | |
| Other Names |