Systematic / IUPAC Name: Chromeno[3,4-b][1,4]benzothiazin-6(12H)-one
ID: Reference4126
Other Names:
Formula: C15H9NO2S
6,12-Dihydrobenzo[b]chromeno[4,3-e][1,4]thiazin-6-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 234 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/9/2016 2:25:06 PM |
| InChI | InChI=1S/C15H9NO2S/c17-15-14-13(9-5-1-3-7-11(9)18-15)16-10-6-2-4-8-12(10)19-14/h1-8,16H |
| InChI Key | BUPPVTUKPWAYCH-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C2C(=C1)C3=C(C(=O)O2)SC4=CC=CC=C4N3 |
| CAS | 75908144 |
| Splash | |
| Other Names |
| ChemIDPlus | 075908144 |
| ChemSpider | 300102 |
| PubChem | 338569 |
| ChEMBL | CHEMBL1977795 |