Systematic / IUPAC Name: 6-[(E)-2-(3,4,5-Trimethoxyphenyl)vinyl]-4,5-dihydro-3(2H)-pyridazinone
ID: Reference4132
Other Names:
Formula: C15H18N2O4
6-(3,4,5-Trimethoxystyryl)-2,3,4,5-tetrahydropyridazin-3-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/10/2016 9:02:51 AM |
| InChI | InChI=1S/C15H18N2O4/c1-19-12-8-10(9-13(20-2)15(12)21-3)4-5-11-6-7-14(18)17-16-11/h4-5,8-9H,6-7H2,1-3H3,(H,17,18)/b5-4+ |
| InChI Key | QRIDCJWQKAVVCA-SNAWJCMRSA-N |
| Canonical SMILES | COC1=CC(=CC(=C1OC)OC)C=CC2=NNC(=O)CC2 |
| CAS | |
| Splash | |
| Other Names |
| ChEMBL | CHEMBL1587032 |
| PubChem | 5703451 |
| ChemSpider | 4643578 |