Systematic / IUPAC Name: 3-Methyl-N-phenyl-1-benzothiophene-2-carbothioamide
ID: Reference4133
Other Names:
Formula: C16H13NS2
N2-Phenyl-3-methylbenzo[b]thiophene-2-carbothioamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 234 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/10/2016 9:04:22 AM |
| InChI | InChI=1S/C16H13NS2/c1-11-13-9-5-6-10-14(13)19-15(11)16(18)17-12-7-3-2-4-8-12/h2-10H,1H3,(H,17,18) |
| InChI Key | BHBKNDXQWDKPHA-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(SC2=CC=CC=C12)C(=S)NC3=CC=CC=C3 |
| CAS | |
| Splash | |
| Other Names |