Systematic / IUPAC Name: 4-(5-Cyano-2H-1,2,3-triazol-4-yl)phenyl 3,5-dimethyl-1,2-oxazole-4-carboxylate
ID: Reference4142
Other Names: 4-Isoxazolecarboxylic acid, 3,5-dimethyl-, 4-(5-cyano-2H-1,2,3-triazol-4-yl)phenyl ester
Formula: C15H11N5O3
4-(5-Cyano-1H-1,2,3-triazol-4-yl)phenyl 3,5-dimethylisoxazole-4-carboxylate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 211 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/10/2016 12:04:32 PM |
| InChI | InChI=1S/C15H11N5O3/c1-8-13(9(2)23-19-8)15(21)22-11-5-3-10(4-6-11)14-12(7-16)17-20-18-14/h3-6H,1-2H3,(H,17,18,20) |
| InChI Key | CNXCQNNJQJMYQB-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C(=NO1)C)C(=O)OC2=CC=C(C=C2)C3=NNN=C3C#N |
| CAS | |
| Splash | |
| Other Names | 4-Isoxazolecarboxylic acid, 3,5-dimethyl-, 4-(5-cyano-2H-1,2,3-triazol-4-yl)phenyl ester |