Systematic / IUPAC Name: Ethyl (phenanthro[9,10-E][1,2,4]triazin-3-ylsulfanyl)acetate
ID: Reference4151
Other Names: Acetic acid, 2-(phenanthro[9,10-E]-1,2,4-triazin-3-ylthio)-, ethyl ester
Formula: C19H15N3O2S
Ethyl 2-(phenanthro[9,10-E][1,2,4]triazin-3-ylthio)acetate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/10/2016 2:12:55 PM |
| InChI | InChI=1S/C19H15N3O2S/c1-2-24-16(23)11-25-19-20-17-14-9-5-3-7-12(14)13-8-4-6-10-15(13)18(17)21-22-19/h3-10H,2,11H2,1H3 |
| InChI Key | ODCHKALMGZNJDE-UHFFFAOYSA-N |
| Canonical SMILES | CCOC(=O)CSC1=NC2=C(C3=CC=CC=C3C4=CC=CC=C42)N=N1 |
| CAS | |
| Splash | |
| Other Names | Acetic acid, 2-(phenanthro[9,10-E]-1,2,4-triazin-3-ylthio)-, ethyl ester |