Systematic / IUPAC Name: 5-(4-Chlorobenzyl)-3-phenyl-1,2,4-triazin-6(1H)-one
ID: Reference4160
Other Names: (5Z)-5-(4-Chlorobenzylidene)-3-phenyl-1,2-dihydro-1,2,4-triazin-6-one
Formula: C16H12ClN3O
5-(4-Chlorobenzyl)-3-phenyl-1,6-dihydro-1,2,4-triazin-6-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 215 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/11/2016 9:19:00 AM |
| InChI | InChI=1S/C16H12ClN3O/c17-13-8-6-11(7-9-13)10-14-16(21)20-19-15(18-14)12-4-2-1-3-5-12/h1-9H,10H2,(H,20,21) |
| InChI Key | XRFZVQYALJCILC-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)C2=NNC(=O)C(=N2)CC3=CC=C(C=C3)Cl |
| CAS | |
| Splash | |
| Other Names | (5Z)-5-(4-Chlorobenzylidene)-3-phenyl-1,2-dihydro-1,2,4-triazin-6-one |