Systematic / IUPAC Name: (2R)-5-oxopyrrolidine-2-carboxylic acid
ID: Reference417
Other Names:
(R)-(+)-2-Pyrrolidone-5-carboxylic acid;
D-5-Pyrrolidone-2-carboxylic acid;
(R)-2-Pyrrolidone-5-carboxylic acid;
D-Pyroglutamic acid;
5-Oxo-D-proline
Formula: C5H7NO3
Class: Endogenous Metabolites
D-(+)-Pyroglutamic Acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 3 |
| No. of Spectra | 622 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 1/16/2015 1:29:32 PM |
| InChI | InChI=1S/C5H7NO3/c7-4-2-1-3(6-4)5(8)9/h3H,1-2H2,(H,6,7)(H,8,9)/t3-/m1/s1 |
| InChI Key | ODHCTXKNWHHXJC-GSVOUGTGSA-N |
| Canonical SMILES | C1CC(=O)NC1C(=O)O |
| CAS | 4042368 |
| Splash | |
| Other Names |
(R)-(+)-2-Pyrrolidone-5-carboxylic acid; D-5-Pyrrolidone-2-carboxylic acid; (R)-2-Pyrrolidone-5-carboxylic acid; D-Pyroglutamic acid; 5-Oxo-D-proline |
| HMDb | HMDB00805 |
| ChEBI | CHEBI:16924 |
| KEGG | C02237 |
| Wikipedia | Pyroglutamic acid |
| ChemSpider | 388752 |
| PubChem | 439685 |