Systematic / IUPAC Name: 5-[(4-Methoxyphenyl)amino]-5-oxo-3-(3,4,5-trimethoxyphenyl)pentanoic acid
ID: Reference4174
Other Names: Benzenepropanoic acid, 3,4,5-trimethoxy-β-{2-[(4-methoxyphenyl)amino]-2-oxoethyl}-
Formula: C21H25NO7
5-(4-Methoxyanilino)-5-oxo-3-(3,4,5-trimethoxyphenyl)pentanoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/11/2016 1:20:30 PM |
| InChI | InChI=1S/C21H25NO7/c1-26-16-7-5-15(6-8-16)22-19(23)11-14(12-20(24)25)13-9-17(27-2)21(29-4)18(10-13)28-3/h5-10,14H,11-12H2,1-4H3,(H,22,23)(H,24,25) |
| InChI Key | WOUOXOYLPRMEPB-UHFFFAOYSA-N |
| Canonical SMILES | COC1=CC=C(C=C1)NC(=O)CC(CC(=O)O)C2=CC(=C(C(=C2)OC)OC)OC |
| CAS | |
| Splash | |
| Other Names | Benzenepropanoic acid, 3,4,5-trimethoxy-β-{2-[(4-methoxyphenyl)amino]-2-oxoethyl}- |