Systematic / IUPAC Name: (2E)-4-{[3-(Diethylammonio)propyl]amino}-4-oxo-2-butenoate
ID: Reference4184
Other Names:
Formula: C11H20N2O3
4-{[3-(Diethylamino)propyl]amino}-4-oxobut-2-enoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 188 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/14/2016 9:44:02 AM |
| InChI | InChI=1S/C11H20N2O3/c1-3-13(4-2)9-5-8-12-10(14)6-7-11(15)16/h6-7H,3-5,8-9H2,1-2H3,(H,12,14)(H,15,16)/b7-6+ |
| InChI Key | SNAWIFGTVBOMDL-VOTSOKGWSA-N |
| Canonical SMILES | CCN(CC)CCCNC(=O)C=CC(=O)O |
| CAS | |
| Splash | |
| Other Names |
| ChemSpider | 1337310 |
| PubChem | 1678791; 1678792 |
| ChEMBL | CHEMBL1345943 |