Systematic / IUPAC Name: 2-(3,4,5-Trimethoxyphenyl)-4H-3,1-benzoxathiin-4-one
ID: Reference4187
Other Names:
Formula: C17H16O5S
2-(3,4,5-Trimethoxyphenyl)-4H-3,1-benzoxathiin-4-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/14/2016 12:12:31 PM |
| InChI | InChI=1S/C17H16O5S/c1-19-12-8-10(9-13(20-2)15(12)21-3)17-22-16(18)11-6-4-5-7-14(11)23-17/h4-9,17H,1-3H3 |
| InChI Key | OMVXBNMLTNAIPZ-UHFFFAOYSA-N |
| Canonical SMILES | COC1=CC(=CC(=C1OC)OC)C2OC(=O)C3=CC=CC=C3S2 |
| CAS | |
| Splash | |
| Other Names |
| ChEMBL | CHEMBL1733508 |
| ChemSpider | 2013188 |
| PubChem | 2731295 |