Systematic / IUPAC Name: 3,4-Dihydroxydihydro-2(3H)-furanone
ID: Reference419
Other Names:
(3R,4S)-3,4-Dihydroxyoxolan-2-one;
(3R,4S)-3,4-Dihydroxydihydrofuran-2(3H)-one;
Threonic acid-1,4-lactone;
Threonolactone
Formula: C4H6O4
Class: Endogenous Metabolites
L-Threonic acid-1,4-lactone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 2 |
| No. of Spectra | 140 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/16/2015 2:31:42 PM |
| InChI | InChI=1S/C4H6O4/c5-2-1-8-4(7)3(2)6/h2-3,5-6H,1H2/t2-,3+/m0/s1 |
| InChI Key | SGMJBNSHAZVGMC-STHAYSLISA-N |
| Canonical SMILES | O=C1OCC(O)C1O |
| CAS | 21730938 |
| Splash | |
| Other Names |
(3R,4S)-3,4-Dihydroxyoxolan-2-one; (3R,4S)-3,4-Dihydroxydihydrofuran-2(3H)-one; Threonic acid-1,4-lactone; Threonolactone |
| ChemSpider | 466979 |
| HMDb | HMDB00940 |
| PubChem | 2724794 |
| ChEBI | CHEBI:71176 |